|
|---|
| Protective clothing for intervention with appropriate boots and gloves (EN 469 + EN 13832 + EN 374) |
| Flash point: | -17 °C |
| Auto-ignition temperature: | 465 °C |
| Explosion limits: | 2.15 - 13 vol % 60 - 310 g/m³ |
| Odour threshold: | 737 - 1574 mg/m³ 306 - 653 ppm |
| pH: | 5 - 6 |
| Log Kow: | -0.23 |
| SADT: | No data available |
| Vapour pressure (20°C): | 240 hPa |
| Vapour pressure (50°C): | 828 hPa |
If tank, rail tank car or highway tank is involved in a fire, ISOLATE for 800 m in all directions; also, consider initial evacuation for 800 m in all directions.
Consider initial downwind evacuation for at least 300 m.
As an immediate precautionary measure, isolate spill or leak area for at least 50 m in all directions.
| UN number | 1090 |
| Hazard identification number | 33 |
| CAS number | 67-64-1 |
| Registration number REACH | 01-2119471330-49 |
| EC index number | 606-001-00-8 |
| EC number | 200-662-2 |
| Hazchem code | *2YE |
| NFPA code | 2-3-0(*) |
| Molecular mass | 58.08 g/mol |
| Ericard number | 3-09 |
| Formula | C3H6O |
| BIG No. | 10001 |
| Product type | Pure substance |
| Use | Solvent Cleansing product Laboratory reagent Chemical raw material |
| Flash point | -17 °C Closed cup |
| Auto-ignition temperature | 465 °C |
| Explosion limits | 2.15 - 13 vol % 60 - 310 g/m³ |
| Minimum ignition energy | 1.15 mJ |
| Specific conductivity | 6E6 pS/m 25 °C |
| Log Kow | -0.23 |
| Boiling point | 56 °C |
| Melting point | -95 °C |
| Dynamic viscosity ( 20 °C ) ( 40 °C ) | 0.32 mPa.s 0.27 mPa.s |
| Vapour pressure ( 20 °C ) ( 50 °C ) | 240 hPa 828 hPa |
Available temperature range | |
| Relative density ( 20 °C ) | 0.79 |
| Relative vapour density | 2.0 |
| Odour threshold | 737 - 1574 mg/m³ 306 - 653 ppm |
| pH | 5 - 6 |
| | |
| SMILES | CC(=O)C |
| InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
| Water | complete |
| Ethanol | complete |
| Ether | complete |
| Dimethyl ether | soluble |
| Petroleum spirit | soluble |
| Chloroform | soluble |
| Dimethylformamide | soluble |
| Oils/fats | soluble |
| Liquid |
| Colourless |
| Aromatic odour |
| Sweet odour |
| Fruity odour |
| Soluble in water |
| Highly volatile |
| Keep upwind |
| Mark the danger area |
| Consider evacuation |
| Seal off low-lying areas |
| Close doors and windows of adjacent premises |
| Stop engines and no smoking |
| No naked flames or sparks |
| Spark- and explosionproof appliances and lighting equipment |
| Keep containers closed |
| Wash contaminated clothes |
| Prevent spreading in sewers |
| Cool tanks/drums with water spray/remove them into safety |
| Physical explosion risk: extinguish/cool from behind cover |
| Do not move the load if exposed to heat |
| After cooling: persistant risk of physical explosion |
| Contain released product, collect/pump into suitable containers |
| Plug the leak, cut off the supply |
| Dam up the liquid spill |
| Try to reduce evaporation |
| Measure the concentration of the explosive gas-air mixture |
| Dilute/disperse combustible gas/vapour with water curtain |
| Provide equipment/receptacles with earthing |
| Do not use compressed air for pumping over spills |
| Take up liquid spill into inert absorbent material, e.g.: sand, earth, vermiculite |
| Scoop absorbed substance into closing containers |
| Spill must not return in its original container |
| Carefully collect the spill/leftovers |
| Damaged/cooled tanks must be emptied |
| Do not use compressed air for pumping over spills |
| Clean contaminated surfaces with an excess of water |
| Take collected spill to manufacturer/competent authority |
| Wash clothing and equipment after handling |
| Gloves (EN 374) |
| Protective goggles (EN 166) |
| Protective clothing (EN 14605 or EN 13034) |
| Large spills/in enclosed spaces: self-contained breathing apparatus (EN 136 + EN 137) |
| Biomonitoring via urine |
| Value | 246 ppm 594 mg/m³ |
| Value | 492 ppm 1187 mg/m³ |
| Value | 500 ppm 1210 mg/m³ |
| Explanation | Public occupational exposure limit value |
| Value | 1000 ppm 2420 mg/m³ |
| Explanation | Public occupational exposure limit value |
| Value | 500 ppm 1210 mg/m³ |
| Explanation | VRC: Valeur réglementaire contraignante |
| Value | 1000 ppm 2420 mg/m³ |
| Explanation | VRC: Valeur réglementaire contraignante |
| Arbeitsplatzgrenzwert | 500 ppm 1200 mg/m³ |
| Erklärung | TRGS 900 |
| Bemerkung | UF: 2 (Ι) |
| Value | 500 ppm 1200 mg/m³ |
| Explanation | MAK |
| Remark | UF: I(2) |
| Remark | UF: I(2) |
| Value | 250 ppm |
| Explanation | TLV - Adopted Value |
| Value | 500 ppm |
| Explanation | TLV - Adopted Value |
| 10 min: | 199 ppm | 480 mg/m³ |
| 30 min: | 199 ppm | 480 mg/m³ |
| 1 h: | 199 ppm | 480 mg/m³ |
| 2 h: | 199 ppm | 480 mg/m³ |
| 4 h: | 199 ppm | 480 mg/m³ |
| 8 h: | 199 ppm | 480 mg/m³ |
| 10 min: | 9108* ppm | 22000* mg/m³ |
| 30 min: | 4968* ppm | 12000* mg/m³ |
| 1 h: | 3229* ppm | 7800* mg/m³ |
| 2 h: | 2153* ppm | 5200* mg/m³ |
| 4 h: | 1449 ppm | 3500 mg/m³ |
| 8 h: | 952.2 ppm | 2300 mg/m³ |
| 10 min: | 16560** ppm | 40000** mg/m³ |
| 30 min: | 8694* ppm | 21000* mg/m³ |
| 1 h: | 5796* ppm | 14000* mg/m³ |
| 2 h: | 3809* ppm | 9200* mg/m³ |
| 4 h: | 2525* ppm | 6100* mg/m³ |
| 8 h: | 1697 ppm | 4100 mg/m³ |
| ETW1: | |
| ETW4: | 500 ppm |
| AC-Erkundungskraftwagens: | E |
| Value: | 2500 ppm |
| 10 Min: | 200 ppm |
| 30 Min: | 200 ppm |
| 60 Min: | 200 ppm |
| 4h: | 200 ppm |
| 8h: | 200 ppm |
| Remarks: | Interim |
| 10 Min: | 9300 ppm |
| 30 Min: | 4900 ppm |
| 60 Min: | 3200 ppm |
| 4h: | 1400 ppm |
| 8h: | 950 ppm |
| Remarks: | Interim |
| 10 Min: | 16000 ppm |
| 30 Min: | 8600 ppm |
| 60 Min: | 5700 ppm |
| 4h: | 2500 ppm |
| 8h: | 1700 ppm |
| Remarks: | Interim |
| PAC1: | 200 ppm | 470 mg/m³ |
| PAC2: | 3200 ppm | 7600 mg/m³ |
| PAC3: | 5700 ppm | 14000 mg/m³ |
| Remarks: | AEGL-1, AEGL-2, AEGL-3 | |
| LIOGS | 003 |
| Measuring range | 100 - 12000 ppm |
| Sensitivity | Standard |
| LIOGS | 013 |
| Measuring range | 40 - 800 ppm |
| Sensitivity | Standard |
| LIOGS | 064 |
| Detection | Indication |
| Sensitivity | Standard |
| Measuring range | 40 - 600 ppm |
| Sensitivity | Standard |
| Gas or Vapour | Acetone |
| Tube No | 10-111-40 |
| Pump Strokes | 1 (Standard) |
| Sensitivity | Standard |
| Gas or Vapour | Acetone |
| Tube No | 10-111-40 |
| Pump Strokes | 2 |
| Sensitivity | Standard |
| Gas or Vapour | Acetone |
| Tube No | 10-111-40 |
| Pump Strokes | 0.5 |
| Sensitivity | Standard |
| Gas or Vapour | Acetone |
| Tube No | 10-137-30 |
| Sensitivity | cross sensitivity |
| Gas or Vapour | Acetone |
| Tube No | 10-121-05 |
| Sensitivity | cross sensitivity |
| Gas or Vapour | Acetone |
| Tube No | 10-138-30 |
| Sensitivity | cross sensitivity |
| Gas or Vapour | Acetone |
| Tube No | 10-110-30 |
| Sensitivity | cross sensitivity |
| Gas or Vapour | Acetone |
| Tube No | 10-113-20 |
| Sensitivity | cross sensitivity |
| Gas or Vapour | Acetone |
| Tube No | 10-120-40 |
| Sensitivity | cross sensitivity |
| Ionization energy | 9.703 ± 0.006 |
| Response factor | 1.15 |
| Response factor | 1.04 |
| Response factor | 1.17 |
| Correction factors | 0.9 |
| Technical Note | TN-106C; 202005/TM |
| Correction factors | 1.4 |
| Technical Note | TN-106C; 202005/TM |
| Correction factors | 1.2 |
| Technical Note | TN-106C; 202005/TM |
| Correction factors | 1.08 |
| Technical Note | TN-106B; 202005/TM |
| Correction factors | 1.2 |
| Technical Note | TN-106B; 202005/TM |
| Correction factors | 1.08 |
| Technical Note | TN-106E; 202005/TM |
| Correction factors | 1.2 |
| Technical Note | TN-106E; 202005/TM |
| Correction factors | 1.08 |
| Technical Note | TN-106F; 202009/GM |
| Correction factors | 1.08 |
| Technical Note | TN-106A; 202005/TM |
| Correction factors | 1.2 |
| Technical Note | TN-106A; 202005/TM |
| Correction factors | 1.08 |
| Technical Note | TN-106D; 202005/TM |
| Correction factors | 0.9 |
| Confirmed value | + |
| Ionization energy | 9.71 |
| Correction factors | 1.4 |
| Confirmed value | + |
| Ionization energy | 9.71 |
| Correction factors | 1.2 |
| Confirmed value | + |
| Ionization energy | 9.71 |
| Highly flammable liquid and vapour. |
| Gas/vapour flammable with air within explosion limits |
| May be ignited by sparks |
| Gas/vapour spreads at floor level: ignition hazard |
| Gas/vapour explosive with air within explosion limits |
| Heat may cause pressure rise in tanks/drums: explosion risk |
| May be ignited by sparks |
| Upon combustion: CO and CO2 are formed |
| Violent to explosive reaction with many compounds |
| Prolonged storage: on exposure to light: release of harmful gases/vapours |
| Reacts violently with (strong) oxidizers: peroxidation resulting in increased fire or explosion risk |
| Odour tolerance may develop |
| May cause drowsiness or dizziness. |
| Slightly irritant to respiratory organs |
| Not irritant to skin |
| Non-toxic in contact with skin (LD50 skin> 5000 mg/kg) |
| Repeated exposure may cause skin dryness or cracking. |
| Causes serious eye irritation. |
| Non-toxic if swallowed (LD50 oral, rat > 5000 mg/kg) |
| Not classified as dangerous for the environment according to the criteria of Regulation (EC) No 1272/2008 |
| Groundwater pollutant |
| Not harmful to fishes |
| Not harmful to crustacea (Daphnia) |
| Not classified as dangerous for the ozone layer (Regulation (EC) No 2024/590) |
| H225 | Highly flammable liquid and vapour. | |||
| H319 | Causes serious eye irritation. | |||
| H336 | May cause drowsiness or dizziness. | |||
| EUH066 | Repeated exposure may cause skin dryness or cracking. | |||
| P210 | Keep away from heat, hot surfaces, sparks, open flames and other ignition sources. No smoking. | |||
| P280 | Wear protective gloves and eye protection/face protection. | |||
| P304 + P340 | IF INHALED: Remove person to fresh air and keep comfortable for breathing. | |||
| P303 + P361 + P353 | IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water or shower. | |||
| P305 + P351 + P338 | IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. | |||
| P312 | Call a POISON CENTER/doctor if you feel unwell. | |||
| Hazard identification number | 33 |
| UN number | 1090 |
| Proper shipping name | acetone |
| Class | 3 |
| Subsidiary risk | |
| Packing group | II |
| Classification code | F1 |
| Transport | Subject |
As an immediate precautionary measure, isolate spill or leak area for at least 50 m in all directions.
Consider initial downwind evacuation for at least 300 m.
If tank, rail tank car or highway tank is involved in a fire, ISOLATE for 800 m in all directions; also, consider initial evacuation for 800 m in all directions.
| Observe (own) safety |
| If possible, approach victim and check vital functions |
| In case of injury and/or intoxication, call the European emergency number 112 |
| Treat symptoms starting with most life-threatening injuries and disorders |
| Keep victim under observation, possibility of delayed symptoms |
| After possible exposure, consult a doctor/medical service |
| Remove victim into fresh air |
| In case of respiratory problems, consult a doctor/medical service |
| If possible, wipe up/dry remove chemical |
| Then rinse/shower immediately with (lukewarm) water |
| If irritation persists, consult a doctor/medical service |
| Rinse immediately with plenty of water |
| Remove contact lenses, if present and easy to do. Continue rinsing. |
| If irritation persists, consult a doctor/medical service |
| Rinse mouth with water |
| If you feel unwell, consult a doctor/medical service |
| Do not wait for symptoms to occur to consult Poison Center |